C25H36N6O6S — CID 19944534
2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 19944534) has the molecular formula C25H36N6O6S and a molecular weight of 548.67 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 19944534 |
| Molecular Formula | C25H36N6O6S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CS)NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H36N6O6S/c1-13(2)9-19(25(36)37)30-24(35)20(12-38)31-23(34)18(7-8-21(27)32)29-22(33)16(26)10-14-11-28-17-6-4-3-5-15(14)17/h3-6,11,13,16,18-20,28,38H,7-10,12,26H2,1-2H3,(H2,27,32)(H,29,33)(H,30,35)(H,31,34)(H,36,37) |
| InChIKey | FFYDHTOUUJGOSP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 209.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|