C24H35N7O6 — CID 18481312
2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18481312) has the molecular formula C24H35N7O6 and a molecular weight of 517.59 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18481312 |
| Molecular Formula | C24H35N7O6 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCC(N)=O)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H35N7O6/c25-10-4-3-7-18(31-22(34)16(26)8-9-20(27)32)23(35)29-13-21(33)30-19(24(36)37)11-14-12-28-17-6-2-1-5-15(14)17/h1-2,5-6,12,16,18-19,28H,3-4,7-11,13,25-26H2,(H2,27,32)(H,29,35)(H,30,33)(H,31,34)(H,36,37) |
| InChIKey | RVNUNVKGSYBXCK-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 235.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|