C25H39N7O5 — CID 25055643
(2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 25055643) has the molecular formula C25H39N7O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 25055643 |
| Molecular Formula | C25H39N7O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C25H39N7O5/c26-11-5-3-8-18(28)23(34)32-21(13-16-14-29-19-9-2-1-7-17(16)19)24(35)30-15-22(33)31-20(25(36)37)10-4-6-12-27/h1-2,7,9,14,18,20-21,29H,3-6,8,10-13,15,26-28H2,(H,30,35)(H,31,33)(H,32,34)(H,36,37)/t18-,20-,21-/m0/s1 |
| InChIKey | WHXLTVVGRFZVII-JBACZVJFSA-N |
| XLogP | -0.53 |
| TPSA | 218.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|