C25H37N7O6 — CID 15072340
(2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 15072340) has the molecular formula C25H37N7O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 15072340 |
| Molecular Formula | C25H37N7O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C25H37N7O6/c1-14(27)22(34)30-15(2)23(35)32-20(11-16-12-28-18-8-4-3-7-17(16)18)24(36)29-13-21(33)31-19(25(37)38)9-5-6-10-26/h3-4,7-8,12,14-15,19-20,28H,5-6,9-11,13,26-27H2,1-2H3,(H,29,36)(H,30,34)(H,31,33)(H,32,35)(H,37,38)/t14-,15-,19-,20-/m0/s1 |
| InChIKey | IWFPHMICJAREGU-SLUIBLPYSA-N |
| XLogP | -1.14 |
| TPSA | 221.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|