C20H29N5O4 — CID 21106032
(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 21106032) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 21106032 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | C[C@@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C20H29N5O4/c1-12(22)18(26)25-17(10-13-11-23-15-7-3-2-6-14(13)15)19(27)24-16(20(28)29)8-4-5-9-21/h2-3,6-7,11-12,16-17,23H,4-5,8-10,21-22H2,1H3,(H,24,27)(H,25,26)(H,28,29)/t12-,16+,17+/m1/s1 |
| InChIKey | PHQXWZGXKAFWAZ-DQYPLSBCSA-N |
| XLogP | 0.24 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|