C25H36N6O7 — CID 18237057
4-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid (PubChem CID 18237057) has the molecular formula C25H36N6O7 and a molecular weight of 532.60 g/mol. Its IUPAC name is 4-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18237057 |
| Molecular Formula | C25H36N6O7 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 4-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid |
| SMILES | CC(N)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H36N6O7/c1-14(27)22(34)29-18(8-4-5-11-26)23(35)30-19(9-10-21(32)33)24(36)31-20(25(37)38)12-15-13-28-17-7-3-2-6-16(15)17/h2-3,6-7,13-14,18-20,28H,4-5,8-12,26-27H2,1H3,(H,29,34)(H,30,35)(H,31,36)(H,32,33)(H,37,38) |
| InChIKey | LLERKUVVHJNCKU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|