C23H34N6O5S — CID 18237282
2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18237282) has the molecular formula C23H34N6O5S and a molecular weight of 506.63 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18237282 |
| Molecular Formula | C23H34N6O5S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(N)C(=O)NC(CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C23H34N6O5S/c1-13(25)20(30)27-17(8-4-5-9-24)21(31)28-18(22(32)29-19(12-35)23(33)34)10-14-11-26-16-7-3-2-6-15(14)16/h2-3,6-7,11,13,17-19,26,35H,4-5,8-10,12,24-25H2,1H3,(H,27,30)(H,28,31)(H,29,32)(H,33,34) |
| InChIKey | UOBYJASAYGGMMT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|