C28H36N6O5 — CID 19947376
6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 19947376) has the molecular formula C28H36N6O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19947376 |
| Molecular Formula | C28H36N6O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C28H36N6O5/c29-13-7-6-12-23(28(38)39)33-25(35)17-32-27(37)24(14-18-8-2-1-3-9-18)34-26(36)21(30)15-19-16-31-22-11-5-4-10-20(19)22/h1-5,8-11,16,21,23-24,31H,6-7,12-15,17,29-30H2,(H,32,37)(H,33,35)(H,34,36)(H,38,39) |
| InChIKey | CBCZIRXOYNQATN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|