C24H36N6O5S — CID 154573201
(2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 154573201) has the molecular formula C24H36N6O5S and a molecular weight of 520.66 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 154573201 |
| Molecular Formula | C24H36N6O5S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C24H36N6O5S/c1-36-11-9-19(23(33)28-14-21(31)29-20(24(34)35)8-4-5-10-25)30-22(32)17(26)12-15-13-27-18-7-3-2-6-16(15)18/h2-3,6-7,13,17,19-20,27H,4-5,8-12,14,25-26H2,1H3,(H,28,33)(H,29,31)(H,30,32)(H,34,35)/t17-,19-,20-/m0/s1 |
| InChIKey | ARLAKNIFHLPINW-IHPCNDPISA-N |
| XLogP | 0.09 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|