C26H38N6O7S — CID 19946506
3-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-[(1-carboxy-3-methylsulfanylpropyl)amino]-4-oxobutanoic acid (PubChem CID 19946506) has the molecular formula C26H38N6O7S and a molecular weight of 578.69 g/mol. Its IUPAC name is 3-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-[(1-carboxy-3-methylsulfanylpropyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-[(1-carboxy-3-methylsulfanylpropyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19946506 |
| Molecular Formula | C26H38N6O7S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 3-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-[(1-carboxy-3-methylsulfanylpropyl)amino]-4-oxobutanoic acid |
| SMILES | CSCCC(NC(=O)C(CC(=O)O)NC(=O)C(CCCCN)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H38N6O7S/c1-40-11-9-20(26(38)39)31-25(37)21(13-22(33)34)32-24(36)19(8-4-5-10-27)30-23(35)17(28)12-15-14-29-18-7-3-2-6-16(15)18/h2-3,6-7,14,17,19-21,29H,4-5,8-13,27-28H2,1H3,(H,30,35)(H,31,37)(H,32,36)(H,33,34)(H,38,39) |
| InChIKey | KUVGVOQMEZGKPO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|