C25H38N6O5 — CID 18298347
6-amino-2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 18298347) has the molecular formula C25H38N6O5 and a molecular weight of 502.62 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18298347 |
| Molecular Formula | C25H38N6O5 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C25H38N6O5/c1-3-15(2)22(27)24(34)31-20(12-16-13-28-18-9-5-4-8-17(16)18)23(33)29-14-21(32)30-19(25(35)36)10-6-7-11-26/h4-5,8-9,13,15,19-20,22,28H,3,6-7,10-12,14,26-27H2,1-2H3,(H,29,33)(H,30,32)(H,31,34)(H,35,36) |
| InChIKey | LTCHHZSCCUCCNZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|