C22H31N5O6 — CID 18298351
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 18298351) has the molecular formula C22H31N5O6 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18298351 |
| Molecular Formula | C22H31N5O6 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C22H31N5O6/c1-3-12(2)19(23)21(31)27-16(8-13-9-24-15-7-5-4-6-14(13)15)20(30)25-10-18(29)26-17(11-28)22(32)33/h4-7,9,12,16-17,19,24,28H,3,8,10-11,23H2,1-2H3,(H,25,30)(H,26,29)(H,27,31)(H,32,33) |
| InChIKey | JEADHKQYSBCIAA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |