C19H26N4O4 — CID 18221927
2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetic acid (PubChem CID 18221927) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18221927 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C19H26N4O4/c1-3-11(2)17(20)19(27)23-15(18(26)22-10-16(24)25)8-12-9-21-14-7-5-4-6-13(12)14/h4-7,9,11,15,17,21H,3,8,10,20H2,1-2H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | WKSHBPRUIRGWRZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |