C23H31N5O7 — CID 18502149
3-[(2-amino-3-methylpentanoyl)amino]-4-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18502149) has the molecular formula C23H31N5O7 and a molecular weight of 489.53 g/mol. Its IUPAC name is 3-[(2-amino-3-methylpentanoyl)amino]-4-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[(2-amino-3-methylpentanoyl)amino]-4-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18502149 |
| Molecular Formula | C23H31N5O7 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 3-[(2-amino-3-methylpentanoyl)amino]-4-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H31N5O7/c1-3-12(2)20(24)23(35)28-17(9-18(29)30)22(34)27-16(21(33)26-11-19(31)32)8-13-10-25-15-7-5-4-6-14(13)15/h4-7,10,12,16-17,20,25H,3,8-9,11,24H2,1-2H3,(H,26,33)(H,27,34)(H,28,35)(H,29,30)(H,31,32) |
| InChIKey | NDJGGZRPBHIVFM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |