C29H46N6O5 — CID 18296017
2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18296017) has the molecular formula C29H46N6O5 and a molecular weight of 558.72 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18296017 |
| Molecular Formula | C29H46N6O5 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H46N6O5/c1-5-18(4)25(31)28(38)33-22(12-8-9-13-30)26(36)34-23(14-17(2)3)27(37)35-24(29(39)40)15-19-16-32-21-11-7-6-10-20(19)21/h6-7,10-11,16-18,22-25,32H,5,8-9,12-15,30-31H2,1-4H3,(H,33,38)(H,34,36)(H,35,37)(H,39,40) |
| InChIKey | YFRVKMJBCKRHQR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|