C29H47N7O5 — CID 18306853
2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18306853) has the molecular formula C29H47N7O5 and a molecular weight of 573.74 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18306853 |
| Molecular Formula | C29H47N7O5 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H47N7O5/c1-3-18(2)25(28(39)35-24(29(40)41)16-19-17-33-22-12-5-4-10-20(19)22)36-27(38)23(13-7-9-15-31)34-26(37)21(32)11-6-8-14-30/h4-5,10,12,17-18,21,23-25,33H,3,6-9,11,13-16,30-32H2,1-2H3,(H,34,37)(H,35,39)(H,36,38)(H,40,41) |
| InChIKey | SBGWWNHIBIPDCD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 218.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|