C29H47N9O5 — CID 18302908
2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18302908) has the molecular formula C29H47N9O5 and a molecular weight of 601.75 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18302908 |
| Molecular Formula | C29H47N9O5 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.37 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H47N9O5/c1-3-17(2)24(27(41)37-23(28(42)43)15-18-16-35-21-11-5-4-9-19(18)21)38-26(40)22(12-8-14-34-29(32)33)36-25(39)20(31)10-6-7-13-30/h4-5,9,11,16-17,20,22-24,35H,3,6-8,10,12-15,30-31H2,1-2H3,(H,36,39)(H,37,41)(H,38,40)(H,42,43)(H4,32,33,34) |
| InChIKey | ZZRUDHORFYPXGX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 256.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|