C28H43N7O6 — CID 18481504
2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 18481504) has the molecular formula C28H43N7O6 and a molecular weight of 573.70 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18481504 |
| Molecular Formula | C28H43N7O6 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCCCN)NC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C28H43N7O6/c1-3-16(2)24(28(40)41)35-27(39)22(14-17-15-32-20-9-5-4-8-18(17)20)34-26(38)21(10-6-7-13-29)33-25(37)19(30)11-12-23(31)36/h4-5,8-9,15-16,19,21-22,24,32H,3,6-7,10-14,29-30H2,1-2H3,(H2,31,36)(H,33,37)(H,34,38)(H,35,39)(H,40,41) |
| InChIKey | WTWHTIKASFOLQL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 235.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|