C24H35N7O6 — CID 18302662
4-amino-2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 18302662) has the molecular formula C24H35N7O6 and a molecular weight of 517.59 g/mol. Its IUPAC name is 4-amino-2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18302662 |
| Molecular Formula | C24H35N7O6 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 4-amino-2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H35N7O6/c1-13(29-22(34)16(26)7-4-5-9-25)21(33)30-18(23(35)31-19(24(36)37)11-20(27)32)10-14-12-28-17-8-3-2-6-15(14)17/h2-3,6,8,12-13,16,18-19,28H,4-5,7,9-11,25-26H2,1H3,(H2,27,32)(H,29,34)(H,30,33)(H,31,35)(H,36,37) |
| InChIKey | ALHHXCAYFPEYMM-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 235.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|