C34H45N7O5 — CID 18309392
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid (PubChem CID 18309392) has the molecular formula C34H45N7O5 and a molecular weight of 631.78 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18309392 |
| Molecular Formula | C34H45N7O5 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C34H45N7O5/c1-20(2)15-30(34(45)46)41-33(44)29(17-22-19-38-27-13-6-4-10-24(22)27)40-32(43)28(39-31(42)25(36)11-7-8-14-35)16-21-18-37-26-12-5-3-9-23(21)26/h3-6,9-10,12-13,18-20,25,28-30,37-38H,7-8,11,14-17,35-36H2,1-2H3,(H,39,42)(H,40,43)(H,41,44)(H,45,46) |
| InChIKey | NFDOWDFKYJPSJC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 208.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|