C26H38N8O7 — CID 18304744
2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18304744) has the molecular formula C26H38N8O7 and a molecular weight of 574.64 g/mol. Its IUPAC name is 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18304744 |
| Molecular Formula | C26H38N8O7 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H38N8O7/c27-10-4-3-6-16(28)23(37)32-18(8-9-21(29)35)24(38)33-19(12-22(30)36)25(39)34-20(26(40)41)11-14-13-31-17-7-2-1-5-15(14)17/h1-2,5,7,13,16,18-20,31H,3-4,6,8-12,27-28H2,(H2,29,35)(H2,30,36)(H,32,37)(H,33,38)(H,34,39)(H,40,41) |
| InChIKey | BESXAILLSKABQL-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 278.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|