C24H36N6O6 — CID 19942288
2-[[6-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 19942288) has the molecular formula C24H36N6O6 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-[[6-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[6-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19942288 |
| Molecular Formula | C24H36N6O6 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-[[6-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C24H36N6O6/c1-13(28-22(33)17(26)11-15-12-27-18-8-4-3-7-16(15)18)21(32)29-19(9-5-6-10-25)23(34)30-20(14(2)31)24(35)36/h3-4,7-8,12-14,17,19-20,27,31H,5-6,9-11,25-26H2,1-2H3,(H,28,33)(H,29,32)(H,30,34)(H,35,36) |
| InChIKey | LJASFMLWRGMJSD-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|