C23H31N7O7 — CID 19942098
5-amino-2-[[4-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-4-oxobutanoyl]amino]-5-oxopentanoic acid (PubChem CID 19942098) has the molecular formula C23H31N7O7 and a molecular weight of 517.54 g/mol. Its IUPAC name is 5-amino-2-[[4-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-4-oxobutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[4-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-4-oxobutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19942098 |
| Molecular Formula | C23H31N7O7 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 5-amino-2-[[4-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-4-oxobutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CC(N)=O)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H31N7O7/c1-11(28-21(34)14(24)8-12-10-27-15-5-3-2-4-13(12)15)20(33)30-17(9-19(26)32)22(35)29-16(23(36)37)6-7-18(25)31/h2-5,10-11,14,16-17,27H,6-9,24H2,1H3,(H2,25,31)(H2,26,32)(H,28,34)(H,29,35)(H,30,33)(H,36,37) |
| InChIKey | PKPBZLAAYCJBDG-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 252.59 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |