C22H29N5O7S — CID 19943651
2-[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]propanoylamino]pentanedioic acid (PubChem CID 19943651) has the molecular formula C22H29N5O7S and a molecular weight of 507.57 g/mol. Its IUPAC name is 2-[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 19943651 |
| Molecular Formula | C22H29N5O7S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 2-[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]propanoylamino]pentanedioic acid |
| SMILES | CC(NC(=O)C(CS)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H29N5O7S/c1-11(19(30)26-16(22(33)34)6-7-18(28)29)25-21(32)17(10-35)27-20(31)14(23)8-12-9-24-15-5-3-2-4-13(12)15/h2-5,9,11,14,16-17,24,35H,6-8,10,23H2,1H3,(H,25,32)(H,26,30)(H,27,31)(H,28,29)(H,33,34) |
| InChIKey | WJVHZTXCNHZERF-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|