C28H43N9O7 — CID 18263203
6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 18263203) has the molecular formula C28H43N9O7 and a molecular weight of 617.71 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18263203 |
| Molecular Formula | C28H43N9O7 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H43N9O7/c29-12-4-3-8-21(27(43)44)36-26(42)22(14-16-15-34-19-7-2-1-6-17(16)19)37-25(41)20(9-5-13-33-28(31)32)35-24(40)18(30)10-11-23(38)39/h1-2,6-7,15,18,20-22,34H,3-5,8-14,29-30H2,(H,35,40)(H,36,42)(H,37,41)(H,38,39)(H,43,44)(H4,31,32,33) |
| InChIKey | IARMWFAICUXOQZ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 294.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|