C28H38N8O7 — CID 19944272
5-[[6-amino-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 19944272) has the molecular formula C28H38N8O7 and a molecular weight of 598.66 g/mol. Its IUPAC name is 5-[[6-amino-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[6-amino-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19944272 |
| Molecular Formula | C28H38N8O7 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 5-[[6-amino-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C28H38N8O7/c29-10-4-3-7-21(26(40)36-23(28(42)43)12-17-14-31-15-33-17)35-27(41)22(8-9-24(37)38)34-25(39)19(30)11-16-13-32-20-6-2-1-5-18(16)20/h1-2,5-6,13-15,19,21-23,32H,3-4,7-12,29-30H2,(H,31,33)(H,34,39)(H,35,41)(H,36,40)(H,37,38)(H,42,43) |
| InChIKey | MTJXOQSPHNUBHF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 258.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|