C26H40N6O6 — CID 19949952
6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 19949952) has the molecular formula C26H40N6O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19949952 |
| Molecular Formula | C26H40N6O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)NC(CCCCN)C(=O)O)C(C)O |
| InChI | InChI=1S/C26H40N6O6/c1-14(2)21(31-23(34)18(28)12-16-13-29-19-9-5-4-8-17(16)19)24(35)32-22(15(3)33)25(36)30-20(26(37)38)10-6-7-11-27/h4-5,8-9,13-15,18,20-22,29,33H,6-7,10-12,27-28H2,1-3H3,(H,30,36)(H,31,34)(H,32,35)(H,37,38) |
| InChIKey | MRXKOFKTGAEPPD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|