C30H40N6O7 — CID 19949552
6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 19949552) has the molecular formula C30H40N6O7 and a molecular weight of 596.69 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19949552 |
| Molecular Formula | C30H40N6O7 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C30H40N6O7/c1-17(37)26(29(41)34-24(30(42)43)8-4-5-13-31)36-28(40)25(14-18-9-11-20(38)12-10-18)35-27(39)22(32)15-19-16-33-23-7-3-2-6-21(19)23/h2-3,6-7,9-12,16-17,22,24-26,33,37-38H,4-5,8,13-15,31-32H2,1H3,(H,34,41)(H,35,39)(H,36,40)(H,42,43) |
| InChIKey | YZYNGYKVHHTYDQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 232.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|