C31H42N6O6 — CID 10121359
(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 10121359) has the molecular formula C31H42N6O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 10121359 |
| Molecular Formula | C31H42N6O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C31H42N6O6/c1-18(2)27(30(41)36-26(31(42)43)15-19-10-12-21(38)13-11-19)37-29(40)25(9-5-6-14-32)35-28(39)23(33)16-20-17-34-24-8-4-3-7-22(20)24/h3-4,7-8,10-13,17-18,23,25-27,34,38H,5-6,9,14-16,32-33H2,1-2H3,(H,35,39)(H,36,41)(H,37,40)(H,42,43)/t23-,25-,26-,27-/m0/s1 |
| InChIKey | AIJRHTMAGRJVQZ-MNUOIFNESA-N |
| XLogP | 1.31 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|