C24H36N6O7 — CID 18744230
6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 18744230) has the molecular formula C24H36N6O7 and a molecular weight of 520.59 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18744230 |
| Molecular Formula | C24H36N6O7 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CO)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C24H36N6O7/c1-13(32)20(23(35)28-18(24(36)37)8-4-5-9-25)30-22(34)19(29-21(33)16(26)12-31)10-14-11-27-17-7-3-2-6-15(14)17/h2-3,6-7,11,13,16,18-20,27,31-32H,4-5,8-10,12,25-26H2,1H3,(H,28,35)(H,29,33)(H,30,34)(H,36,37) |
| InChIKey | SUDDFFKEOLCMFL-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 232.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|