C26H41N11O5 — CID 22650910
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid (PubChem CID 22650910) has the molecular formula C26H41N11O5 and a molecular weight of 587.69 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22650910 |
| Molecular Formula | C26H41N11O5 |
| Molecular Weight | 587.69 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H41N11O5/c1-14(24(41)42)35-22(39)19(9-5-11-33-26(30)31)36-23(40)20(12-15-13-34-18-8-3-2-6-16(15)18)37-21(38)17(27)7-4-10-32-25(28)29/h2-3,6,8,13-14,17,19-20,34H,4-5,7,9-12,27H2,1H3,(H,35,39)(H,36,40)(H,37,38)(H,41,42)(H4,28,29,32)(H4,30,31,33) |
| InChIKey | TYZMUOFOAXCVPL-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 295.21 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.69 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|