C33H42N10O6 — CID 19944784
2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19944784) has the molecular formula C33H42N10O6 and a molecular weight of 674.76 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19944784 |
| Molecular Formula | C33H42N10O6 |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C33H42N10O6/c34-22(14-18-16-39-23-8-3-1-6-20(18)23)29(45)41-25(11-12-28(35)44)30(46)43-27(15-19-17-40-24-9-4-2-7-21(19)24)31(47)42-26(32(48)49)10-5-13-38-33(36)37/h1-4,6-9,16-17,22,25-27,39-40H,5,10-15,34H2,(H2,35,44)(H,41,45)(H,42,47)(H,43,46)(H,48,49)(H4,36,37,38) |
| InChIKey | NZEBLJLEEJBBAM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 289.69 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|