C31H39N9O6 — CID 19942801
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 19942801) has the molecular formula C31H39N9O6 and a molecular weight of 633.71 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 19942801 |
| Molecular Formula | C31H39N9O6 |
| Molecular Weight | 633.71 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C31H39N9O6/c32-21(12-17-14-36-22-8-3-1-6-19(17)22)27(42)38-24(10-5-11-35-31(33)34)28(43)39-25(29(44)40-26(16-41)30(45)46)13-18-15-37-23-9-4-2-7-20(18)23/h1-4,6-9,14-15,21,24-26,36-37,41H,5,10-13,16,32H2,(H,38,42)(H,39,43)(H,40,44)(H,45,46)(H4,33,34,35) |
| InChIKey | XQPDTSIQAODNRX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 266.83 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.71 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|