C24H34N8O8 — CID 18247220
3-amino-4-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18247220) has the molecular formula C24H34N8O8 and a molecular weight of 562.58 g/mol. Its IUPAC name is 3-amino-4-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18247220 |
| Molecular Formula | C24H34N8O8 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 3-amino-4-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)CC(=O)O)C(=O)NC(CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H34N8O8/c25-14(9-19(34)35)20(36)30-16(6-3-7-28-24(26)27)21(37)32-18(11-33)22(38)31-17(23(39)40)8-12-10-29-15-5-2-1-4-13(12)15/h1-2,4-5,10,14,16-18,29,33H,3,6-9,11,25H2,(H,30,36)(H,31,38)(H,32,37)(H,34,35)(H,39,40)(H4,26,27,28) |
| InChIKey | DMXAJSGEARTHNO-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 288.34 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|