C25H36N8O8 — CID 18242862
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18242862) has the molecular formula C25H36N8O8 and a molecular weight of 576.61 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242862 |
| Molecular Formula | C25H36N8O8 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C25H36N8O8/c26-15(5-3-9-29-25(27)28)21(37)31-17(7-8-20(35)36)22(38)32-18(23(39)33-19(12-34)24(40)41)10-13-11-30-16-6-2-1-4-14(13)16/h1-2,4,6,11,15,17-19,30,34H,3,5,7-10,12,26H2,(H,31,37)(H,32,38)(H,33,39)(H,35,36)(H,40,41)(H4,27,28,29) |
| InChIKey | QZTYYIMLTXTQBR-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 288.34 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|