C26H36N8O9 — CID 18242584
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[3-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18242584) has the molecular formula C26H36N8O9 and a molecular weight of 604.62 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[3-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[3-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242584 |
| Molecular Formula | C26H36N8O9 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[3-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H36N8O9/c27-15(5-3-9-30-26(28)29)22(39)32-17(7-8-20(35)36)23(40)33-18(11-21(37)38)24(41)34-19(25(42)43)10-13-12-31-16-6-2-1-4-14(13)16/h1-2,4,6,12,15,17-19,31H,3,5,7-11,27H2,(H,32,39)(H,33,40)(H,34,41)(H,35,36)(H,37,38)(H,42,43)(H4,28,29,30) |
| InChIKey | JKMWOOWYPHAQPE-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 305.41 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|