C25H36N8O7S — CID 18264084
4-amino-5-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18264084) has the molecular formula C25H36N8O7S and a molecular weight of 592.68 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18264084 |
| Molecular Formula | C25H36N8O7S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 4-amino-5-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CS)NC(=O)C(N)CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H36N8O7S/c26-15(7-8-20(34)35)21(36)33-19(12-41)23(38)31-17(6-3-9-29-25(27)28)22(37)32-18(24(39)40)10-13-11-30-16-5-2-1-4-14(13)16/h1-2,4-5,11,15,17-19,30,41H,3,6-10,12,26H2,(H,31,38)(H,32,37)(H,33,36)(H,34,35)(H,39,40)(H4,27,28,29) |
| InChIKey | ITXINBNOIBLQSZ-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|