C24H34N8O7S — CID 22650952
3-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid (PubChem CID 22650952) has the molecular formula C24H34N8O7S and a molecular weight of 578.65 g/mol. Its IUPAC name is 3-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22650952 |
| Molecular Formula | C24H34N8O7S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 3-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C24H34N8O7S/c25-14(5-3-7-28-24(26)27)20(35)30-16(8-12-10-29-15-6-2-1-4-13(12)15)21(36)31-17(9-19(33)34)22(37)32-18(11-40)23(38)39/h1-2,4,6,10,14,16-18,29,40H,3,5,7-9,11,25H2,(H,30,35)(H,31,36)(H,32,37)(H,33,34)(H,38,39)(H4,26,27,28) |
| InChIKey | ZIVWFSWMBHMCOF-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|