C25H37N9O6S — CID 18242245
2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18242245) has the molecular formula C25H37N9O6S and a molecular weight of 591.70 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18242245 |
| Molecular Formula | C25H37N9O6S |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CS)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H37N9O6S/c26-15(5-3-9-30-25(28)29)21(36)34-19(12-41)23(38)32-17(7-8-20(27)35)22(37)33-18(24(39)40)10-13-11-31-16-6-2-1-4-14(13)16/h1-2,4,6,11,15,17-19,31,41H,3,5,7-10,12,26H2,(H2,27,35)(H,32,38)(H,33,37)(H,34,36)(H,39,40)(H4,28,29,30) |
| InChIKey | WJESJJMWZQCUDR-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 273.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|