C27H38N8O9 — CID 18242624
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[4-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18242624) has the molecular formula C27H38N8O9 and a molecular weight of 618.65 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[4-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[4-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242624 |
| Molecular Formula | C27H38N8O9 |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[4-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H38N8O9/c28-16(5-3-11-31-27(29)30)23(40)33-18(7-9-21(36)37)24(41)34-19(8-10-22(38)39)25(42)35-20(26(43)44)12-14-13-32-17-6-2-1-4-15(14)17/h1-2,4,6,13,16,18-20,32H,3,5,7-12,28H2,(H,33,40)(H,34,41)(H,35,42)(H,36,37)(H,38,39)(H,43,44)(H4,29,30,31) |
| InChIKey | VSDZNWPETIRWDG-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 305.41 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|