C24H35N9O7 — CID 22650943
2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 22650943) has the molecular formula C24H35N9O7 and a molecular weight of 561.60 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 22650943 |
| Molecular Formula | C24H35N9O7 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C24H35N9O7/c25-14(5-3-7-29-24(27)28)20(36)31-16(8-12-10-30-15-6-2-1-4-13(12)15)21(37)32-17(9-19(26)35)22(38)33-18(11-34)23(39)40/h1-2,4,6,10,14,16-18,30,34H,3,5,7-9,11,25H2,(H2,26,35)(H,31,36)(H,32,37)(H,33,38)(H,39,40)(H4,27,28,29) |
| InChIKey | YDZHHSFGKMMKPH-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 294.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|