C26H39N9O6S — CID 22650940
2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 22650940) has the molecular formula C26H39N9O6S and a molecular weight of 605.72 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22650940 |
| Molecular Formula | C26H39N9O6S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CC(N)=O)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H39N9O6S/c1-42-10-8-18(25(40)41)33-24(39)20(12-21(28)36)35-23(38)19(11-14-13-32-17-7-3-2-5-15(14)17)34-22(37)16(27)6-4-9-31-26(29)30/h2-3,5,7,13,16,18-20,32H,4,6,8-12,27H2,1H3,(H2,28,36)(H,33,39)(H,34,37)(H,35,38)(H,40,41)(H4,29,30,31) |
| InChIKey | DSOVVCRZLCEETK-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 273.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|