C25H36N10O7 — CID 22658899
2-[[4-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 22658899) has the molecular formula C25H36N10O7 and a molecular weight of 588.63 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22658899 |
| Molecular Formula | C25H36N10O7 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 2-[[4-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H36N10O7/c26-14(9-19(27)36)21(38)34-17(8-12-11-32-15-5-2-1-4-13(12)15)22(39)35-18(10-20(28)37)23(40)33-16(24(41)42)6-3-7-31-25(29)30/h1-2,4-5,11,14,16-18,32H,3,6-10,26H2,(H2,27,36)(H2,28,37)(H,33,40)(H,34,38)(H,35,39)(H,41,42)(H4,29,30,31) |
| InChIKey | VKIXWAOAWORZPJ-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 316.99 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|