C26H38N10O7 — CID 19942872
5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 19942872) has the molecular formula C26H38N10O7 and a molecular weight of 602.65 g/mol. Its IUPAC name is 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19942872 |
| Molecular Formula | C26H38N10O7 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H38N10O7/c27-15(10-13-12-33-16-5-2-1-4-14(13)16)22(39)36-19(11-21(29)38)24(41)34-17(6-3-9-32-26(30)31)23(40)35-18(25(42)43)7-8-20(28)37/h1-2,4-5,12,15,17-19,33H,3,6-11,27H2,(H2,28,37)(H2,29,38)(H,34,41)(H,35,40)(H,36,39)(H,42,43)(H4,30,31,32) |
| InChIKey | AXAWCOQBYWIPLM-UHFFFAOYSA-N |
| XLogP | -3.23 |
| TPSA | 316.99 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|