C31H40N8O8 — CID 22651250
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid (PubChem CID 22651250) has the molecular formula C31H40N8O8 and a molecular weight of 652.71 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22651250 |
| Molecular Formula | C31H40N8O8 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C31H40N8O8/c32-21(5-3-13-35-31(33)34)27(43)38-25(15-18-16-36-22-6-2-1-4-20(18)22)29(45)39-24(14-17-7-9-19(40)10-8-17)28(44)37-23(30(46)47)11-12-26(41)42/h1-2,4,6-10,16,21,23-25,36,40H,3,5,11-15,32H2,(H,37,44)(H,38,43)(H,39,45)(H,41,42)(H,46,47)(H4,33,34,35) |
| InChIKey | SDUHFZFNEUHWJV-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 288.34 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|