C31H40N8O7 — CID 19942714
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid (PubChem CID 19942714) has the molecular formula C31H40N8O7 and a molecular weight of 636.71 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19942714 |
| Molecular Formula | C31H40N8O7 |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C31H40N8O7/c32-21(16-19-17-36-22-10-5-4-9-20(19)22)27(42)37-23(11-6-14-35-31(33)34)28(43)39-25(15-18-7-2-1-3-8-18)29(44)38-24(30(45)46)12-13-26(40)41/h1-5,7-10,17,21,23-25,36H,6,11-16,32H2,(H,37,42)(H,38,44)(H,39,43)(H,40,41)(H,45,46)(H4,33,34,35) |
| InChIKey | JJINLPXGKHFTOV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|