C28H42N8O7 — CID 19946065
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid (PubChem CID 19946065) has the molecular formula C28H42N8O7 and a molecular weight of 602.69 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19946065 |
| Molecular Formula | C28H42N8O7 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H42N8O7/c1-15(2)12-22(36-24(39)18(29)13-16-14-33-19-7-4-3-6-17(16)19)26(41)34-20(8-5-11-32-28(30)31)25(40)35-21(27(42)43)9-10-23(37)38/h3-4,6-7,14-15,18,20-22,33H,5,8-13,29H2,1-2H3,(H,34,41)(H,35,40)(H,36,39)(H,37,38)(H,42,43)(H4,30,31,32) |
| InChIKey | WSGZMBKFQWULKB-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|