C27H40N8O7S — CID 19942694
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid (PubChem CID 19942694) has the molecular formula C27H40N8O7S and a molecular weight of 620.73 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19942694 |
| Molecular Formula | C27H40N8O7S |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid |
| SMILES | CSCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H40N8O7S/c1-43-12-10-20(25(40)35-21(26(41)42)8-9-22(36)37)34-24(39)19(7-4-11-31-27(29)30)33-23(38)17(28)13-15-14-32-18-6-3-2-5-16(15)18/h2-3,5-6,14,17,19-21,32H,4,7-13,28H2,1H3,(H,33,38)(H,34,39)(H,35,40)(H,36,37)(H,41,42)(H4,29,30,31) |
| InChIKey | INVCXSYUOMNNRO-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|