C32H44N8O6 — CID 22651502
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 22651502) has the molecular formula C32H44N8O6 and a molecular weight of 636.75 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22651502 |
| Molecular Formula | C32H44N8O6 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C32H44N8O6/c1-18(2)14-25(29(43)40-27(31(45)46)16-20-17-37-24-8-4-3-6-22(20)24)39-30(44)26(15-19-9-11-21(41)12-10-19)38-28(42)23(33)7-5-13-36-32(34)35/h3-4,6,8-12,17-18,23,25-27,37,41H,5,7,13-16,33H2,1-2H3,(H,38,42)(H,39,44)(H,40,43)(H,45,46)(H4,34,35,36) |
| InChIKey | OKTDGFYLESAQCR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 251.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|