C29H38N8O6 — CID 19942410
2-[[2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19942410) has the molecular formula C29H38N8O6 and a molecular weight of 594.67 g/mol. Its IUPAC name is 2-[[2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19942410 |
| Molecular Formula | C29H38N8O6 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | 2-[[2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C29H38N8O6/c1-16(35-26(40)21(30)14-18-15-34-22-6-3-2-5-20(18)22)25(39)37-24(13-17-8-10-19(38)11-9-17)27(41)36-23(28(42)43)7-4-12-33-29(31)32/h2-3,5-6,8-11,15-16,21,23-24,34,38H,4,7,12-14,30H2,1H3,(H,35,40)(H,36,41)(H,37,39)(H,42,43)(H4,31,32,33) |
| InChIKey | BSEFSNMXTKTEAM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 251.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|